About 6-methyl-3,4-dihydrocinnoline
6-methyl-3,4-dihydrocinnoline (PubChem CID 58369743) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 6-methyl-3,4-dihydrocinnoline.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydrocinnoline |
| PubChem CID | 58369743 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 6-methyl-3,4-dihydrocinnoline |
| SMILES | Cc1ccc2c(c1)CCN=N2 |
| InChI | InChI=1S/C9H10N2/c1-7-2-3-9-8(6-7)4-5-10-11-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | CPPPPZGDYAPDAX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3,4-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydrocinnoline?
The IUPAC name of 6-methyl-3,4-dihydrocinnoline (CID 58369743) is 6-methyl-3,4-dihydrocinnoline.
What is the SMILES notation for 6-methyl-3,4-dihydrocinnoline?
The canonical SMILES for 6-methyl-3,4-dihydrocinnoline is Cc1ccc2c(c1)CCN=N2.
What is the InChIKey of 6-methyl-3,4-dihydrocinnoline?
The InChIKey is CPPPPZGDYAPDAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-2-3-9-8(6-7)4-5-10-11-9/h2-3,6H,4-5H2,1H3.
What are the key properties of 6-methyl-3,4-dihydrocinnoline?
6-methyl-3,4-dihydrocinnoline has a molecular weight of 146.19 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydrocinnoline is sourced from PubChem (CID 58369743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).