C29H24N4O2S — CID 58369776
33-thia-12,14,25,27-tetrazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione (PubChem CID 58369776) has the molecular formula C29H24N4O2S and a molecular weight of 492.60 g/mol. Its IUPAC name is 33-thia-12,14,25,27-tetrazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione.
| Compound Name | 33-thia-12,14,25,27-tetrazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione |
|---|---|
| PubChem CID | 58369776 |
| Molecular Formula | C29H24N4O2S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 33-thia-12,14,25,27-tetrazaheptacyclo[23.6.1.17,14.118,21.02,6.08,13.026,31]tetratriaconta-1(32),2(6),7(34),8(13),9,11,18,20,26(31),27,29-undecaene-3,5-dione |
| SMILES | O=C1CC(=O)C2=C1c1cn(c3ncccc13)CCCc1ccc(s1)CCCn1cc2c2cccnc21 |
| InChI | InChI=1S/C29H24N4O2S/c34-24-15-25(35)27-23-17-33(29-21(23)8-2-12-31-29)14-4-6-19-10-9-18(36-19)5-3-13-32-16-22(26(24)27)20-7-1-11-30-28(20)32/h1-2,7-12,16-17H,3-6,13-15H2 |
| InChIKey | UMJSCKKZWGDEEM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|