C31H33N3O4 — CID 58369778
20-ethyl-17,23-dioxa-14,20,26-triazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione (PubChem CID 58369778) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is 20-ethyl-17,23-dioxa-14,20,26-triazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione.
| Compound Name | 20-ethyl-17,23-dioxa-14,20,26-triazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione |
|---|---|
| PubChem CID | 58369778 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 20-ethyl-17,23-dioxa-14,20,26-triazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione |
| SMILES | CCN1CCOCCn2cc(c3ccccc32)C2=C(C(=O)CC2=O)c2cn(c3ccccc23)CCOCC1 |
| InChI | InChI=1S/C31H33N3O4/c1-2-32-11-15-37-17-13-33-20-24(22-7-3-5-9-26(22)33)30-28(35)19-29(36)31(30)25-21-34(14-18-38-16-12-32)27-10-6-4-8-23(25)27/h3-10,20-21H,2,11-19H2,1H3 |
| InChIKey | XSLALJGBBVXEQA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|