C15H27NO6 — CID 58369883
dimethyl 2-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]propanedioate (PubChem CID 58369883) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is dimethyl 2-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]propanedioate.
| Compound Name | dimethyl 2-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]propanedioate |
|---|---|
| PubChem CID | 58369883 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | dimethyl 2-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]propanedioate |
| SMILES | COC(=O)C(CON1C(C)(C)CC(O)CC1(C)C)C(=O)OC |
| InChI | InChI=1S/C15H27NO6/c1-14(2)7-10(17)8-15(3,4)16(14)22-9-11(12(18)20-5)13(19)21-6/h10-11,17H,7-9H2,1-6H3 |
| InChIKey | ZPVALNVETBBPIS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|