C26H36N4O7S — CID 58369899
8-amino-5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]-4,8-dioxooctanoic acid (PubChem CID 58369899) has the molecular formula C26H36N4O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is 8-amino-5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]-4,8-dioxooctanoic acid.
| Compound Name | 8-amino-5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]-4,8-dioxooctanoic acid |
|---|---|
| PubChem CID | 58369899 |
| Molecular Formula | C26H36N4O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 8-amino-5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoylamino]-4,8-dioxooctanoic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCC(=O)NC(CCC(N)=O)C(=O)CCC(=O)O)cccc12 |
| InChI | InChI=1S/C26H36N4O7S/c1-30(2)21-10-6-9-19-18(21)8-7-11-23(19)38(36,37)28-17-5-3-4-12-25(33)29-20(13-15-24(27)32)22(31)14-16-26(34)35/h6-11,20,28H,3-5,12-17H2,1-2H3,(H2,27,32)(H,29,33)(H,34,35) |
| InChIKey | VEECIISLDFRRFR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|