C22H25IN4O3S — CID 58369948
7-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-methyl-N-[2-(methylperoxymethyliodanuidyl)ethyl]-2,1,3-benzoxadiazol-4-amine (PubChem CID 58369948) has the molecular formula C22H25IN4O3S and a molecular weight of 552.44 g/mol. Its IUPAC name is 7-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-methyl-N-[2-(methylperoxymethyliodanuidyl)ethyl]-2,1,3-benzoxadiazol-4-amine.
| Compound Name | 7-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-methyl-N-[2-(methylperoxymethyliodanuidyl)ethyl]-2,1,3-benzoxadiazol-4-amine |
|---|---|
| PubChem CID | 58369948 |
| Molecular Formula | C22H25IN4O3S |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 7-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-methyl-N-[2-(methylperoxymethyliodanuidyl)ethyl]-2,1,3-benzoxadiazol-4-amine |
| SMILES | CC[n+]1c(/C=C/c2ccc(N(C)CC[I-]COOC)c3nonc23)sc2ccccc21 |
| InChI | InChI=1S/C22H25IN4O3S/c1-4-27-17-7-5-6-8-19(17)31-20(27)12-10-16-9-11-18(22-21(16)24-30-25-22)26(2)14-13-23-15-29-28-3/h5-12H,4,13-15H2,1-3H3 |
| InChIKey | YIDADZUBJUBBBY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|