C5H2F7N3 — CID 58370464
3-(1,1,2,2-tetrafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 58370464) has the molecular formula C5H2F7N3 and a molecular weight of 237.08 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-(1,1,2,2-tetrafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 58370464 |
| Molecular Formula | C5H2F7N3 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)C(F)(F)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C5H2F7N3/c6-1(7)4(8,9)2-13-3(15-14-2)5(10,11)12/h1H,(H,13,14,15) |
| InChIKey | OPJXYRXVUADIQV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|