C6H3F8N3 — CID 58370560
3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole (PubChem CID 58370560) has the molecular formula C6H3F8N3 and a molecular weight of 269.10 g/mol. Its IUPAC name is 3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole.
| Compound Name | 3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 58370560 |
| Molecular Formula | C6H3F8N3 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)C(F)(F)c1n[nH]c(C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C6H3F8N3/c7-1(8)5(11,12)3-15-4(17-16-3)6(13,14)2(9)10/h1-2H,(H,15,16,17) |
| InChIKey | CTTAAOIFKPOBTK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|