C35H50O5Si — CID 58370612
(5R)-6-[(2S,3aR,7aS)-2-butyl-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-5-methylhexane-2,4-dione (PubChem CID 58370612) has the molecular formula C35H50O5Si and a molecular weight of 578.87 g/mol. Its IUPAC name is (5R)-6-[(2S,3aR,7aS)-2-butyl-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-5-methylhexane-2,4-dione.
| Compound Name | (5R)-6-[(2S,3aR,7aS)-2-butyl-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-5-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 58370612 |
| Molecular Formula | C35H50O5Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | (5R)-6-[(2S,3aR,7aS)-2-butyl-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-5-methylhexane-2,4-dione |
| SMILES | CCCC[C@H]1C[C@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(C[C@@H](C)C(=O)CC(C)=O)CC[C@@H]2O1 |
| InChI | InChI=1S/C35H50O5Si/c1-7-8-15-29-24-35(33(39-29)21-20-28(40-35)22-26(2)32(37)23-27(3)36)25-38-41(34(4,5)6,30-16-11-9-12-17-30)31-18-13-10-14-19-31/h9-14,16-19,26,28-29,33H,7-8,15,20-25H2,1-6H3/t26-,28?,29+,33+,35-/m1/s1 |
| InChIKey | GKZUQMWQEFVPQV-OCYWVOJUSA-N |
| XLogP | 6.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|