C18H28F3IO5S — CID 58370618
[(3R)-4-[(2S,3aS,7aS)-2-butyl-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 58370618) has the molecular formula C18H28F3IO5S and a molecular weight of 540.38 g/mol. Its IUPAC name is [(3R)-4-[(2S,3aS,7aS)-2-butyl-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3R)-4-[(2S,3aS,7aS)-2-butyl-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58370618 |
| Molecular Formula | C18H28F3IO5S |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | [(3R)-4-[(2S,3aS,7aS)-2-butyl-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)[C@H](C)CC1CC[C@@H]2O[C@@H](CCCC)C[C@]2(CI)O1 |
| InChI | InChI=1S/C18H28F3IO5S/c1-4-5-6-15-10-17(11-22)16(25-15)8-7-14(26-17)9-12(2)13(3)27-28(23,24)18(19,20)21/h12,14-16H,3-11H2,1-2H3/t12-,14?,15+,16+,17-/m1/s1 |
| InChIKey | ANEPZOSIAQRBQC-BKKDVFGPSA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|