C37H60O5S — CID 58370622
(3R,5R,7R)-8-[(3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-(2-methylbutyl)oxolan-2-yl]-1-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-5,7-dimethyl-6-methylideneoctan-3-ol (PubChem CID 58370622) has the molecular formula C37H60O5S and a molecular weight of 616.95 g/mol. Its IUPAC name is (3R,5R,7R)-8-[(3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-(2-methylbutyl)oxolan-2-yl]-1-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-5,7-dimethyl-6-methylideneoctan-3-ol.
| Compound Name | (3R,5R,7R)-8-[(3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-(2-methylbutyl)oxolan-2-yl]-1-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-5,7-dimethyl-6-methylideneoctan-3-ol |
|---|---|
| PubChem CID | 58370622 |
| Molecular Formula | C37H60O5S |
| Molecular Weight | 616.95 g/mol |
| Exact Mass | 616.42 |
| IUPAC Name | (3R,5R,7R)-8-[(3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-(2-methylbutyl)oxolan-2-yl]-1-[(5S)-5-butyl-3-methylideneoxolan-2-yl]-5,7-dimethyl-6-methylideneoctan-3-ol |
| SMILES | C=C1C[C@H](CCCC)OC1CC[C@@H](O)C[C@@H](C)C(=C)[C@H](C)CC1O[C@H](CC(C)CC)[C@H](C)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H60O5S/c1-9-11-15-32-22-28(6)35(41-32)19-18-31(38)21-26(4)29(7)27(5)23-37-34(30(8)36(42-37)20-25(3)10-2)24-43(39,40)33-16-13-12-14-17-33/h12-14,16-17,25-27,30-32,34-38H,6-7,9-11,15,18-24H2,1-5,8H3/t25?,26-,27-,30-,31-,32+,34-,35?,36-,37?/m1/s1 |
| InChIKey | PEEPRFJJJJPZRK-KGVGPJABSA-N |
| XLogP | 8.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.95 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|