C19H28O4S — CID 58370637
2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]acetaldehyde (PubChem CID 58370637) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 58370637 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]acetaldehyde |
| SMILES | CC[C@@H](C)C[C@H]1O[C@@H](CC=O)[C@H](CS(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H28O4S/c1-4-14(2)12-19-15(3)17(18(23-19)10-11-20)13-24(21,22)16-8-6-5-7-9-16/h5-9,11,14-15,17-19H,4,10,12-13H2,1-3H3/t14-,15-,17-,18+,19-/m1/s1 |
| InChIKey | YGQASPXJCGJYLQ-SIZVQLJJSA-N |
| XLogP | 3.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|