C20H16IN3 — CID 58370642
4-azido-5-iodo-3,6-dimethyl-1,8-dimethylidene-4,5-dihydropyrene (PubChem CID 58370642) has the molecular formula C20H16IN3 and a molecular weight of 425.27 g/mol. Its IUPAC name is 4-azido-5-iodo-3,6-dimethyl-1,8-dimethylidene-4,5-dihydropyrene.
| Compound Name | 4-azido-5-iodo-3,6-dimethyl-1,8-dimethylidene-4,5-dihydropyrene |
|---|---|
| PubChem CID | 58370642 |
| Molecular Formula | C20H16IN3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 4-azido-5-iodo-3,6-dimethyl-1,8-dimethylidene-4,5-dihydropyrene |
| SMILES | C=c1cc(C)c2c3c1ccc1c(=C)cc(C)c(c13)C(N=[N+]=[N-])C2I |
| InChI | InChI=1S/C20H16IN3/c1-9-7-11(3)15-17-13(9)5-6-14-10(2)8-12(4)16(18(14)17)20(19(15)21)23-24-22/h5-8,19-20H,1-2H2,3-4H3 |
| InChIKey | JPKYRYYHVRQPLW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|