C27H42O2 — CID 58370649
(1S,3S,5S)-1-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6,6-dimethylhept-4-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-hydroxyethyl]bicyclo[3.1.0]hexan-3-ol (PubChem CID 58370649) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (1S,3S,5S)-1-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6,6-dimethylhept-4-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-hydroxyethyl]bicyclo[3.1.0]hexan-3-ol.
| Compound Name | (1S,3S,5S)-1-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6,6-dimethylhept-4-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-hydroxyethyl]bicyclo[3.1.0]hexan-3-ol |
|---|---|
| PubChem CID | 58370649 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (1S,3S,5S)-1-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6,6-dimethylhept-4-yn-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-hydroxyethyl]bicyclo[3.1.0]hexan-3-ol |
| SMILES | C[C@H](CC#CC(C)(C)C)[C@H]1CC[C@@H]2/C(=C/C(O)[C@@]34C[C@@H](O)C[C@@H]3C4)CCC[C@@]21C |
| InChI | InChI=1S/C27H42O2/c1-18(8-6-12-25(2,3)4)22-10-11-23-19(9-7-13-26(22,23)5)14-24(29)27-16-20(27)15-21(28)17-27/h14,18,20-24,28-29H,7-11,13,15-17H2,1-5H3/b19-14+/t18-,20-,21+,22-,23-,24?,26-,27+/m1/s1 |
| InChIKey | JGUPNLLKBGVBQZ-KKSZVMAHSA-N |
| XLogP | 5.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|