C28H23N5O6+2 — CID 58370731
16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaene-14,18-dione (PubChem CID 58370731) has the molecular formula C28H23N5O6+2 and a molecular weight of 525.52 g/mol. Its IUPAC name is 16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaene-14,18-dione.
| Compound Name | 16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaene-14,18-dione |
|---|---|
| PubChem CID | 58370731 |
| Molecular Formula | C28H23N5O6+2 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 16-[4,5-bis(hydroxymethyl)-2-nitrophenyl]-13,17-diaza-2,24-diazoniahexacyclo[11.11.0.01,17.02,11.04,9.019,24]tetracosa-2,4,6,8,10,19,21,23-octaene-14,18-dione |
| SMILES | O=C1CC(c2cc(CO)c(CO)cc2[N+](=O)[O-])N2C(=O)c3cccc[n+]3C23N1Cc1cc2ccccc2c[n+]13 |
| InChI | InChI=1S/C28H23N5O6/c34-15-19-10-22(25(33(38)39)11-20(19)16-35)24-12-26(36)31-14-21-9-17-5-1-2-6-18(17)13-30(21)28(31)29-8-4-3-7-23(29)27(37)32(24)28/h1-11,13,24,34-35H,12,14-16H2/q+2 |
| InChIKey | KTOJKTXZGOGSDX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|