C9H12BrN3O — CID 58371973
4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide (PubChem CID 58371973) has the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. Its IUPAC name is 4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide.
| Compound Name | 4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 58371973 |
| Molecular Formula | C9H12BrN3O |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide |
| SMILES | N/C(=N\NCCO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H12BrN3O/c10-8-3-1-7(2-4-8)9(11)13-12-5-6-14/h1-4,12,14H,5-6H2,(H2,11,13) |
| InChIKey | BWFNUGGBBCHWJD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|