C39H40F6N2O2 — CID 58372156
3-(4-tert-butylphenyl)-6-[1,1,1,3,3,3-hexafluoro-2-[3-[4-(2-methylpropyl)phenyl]-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 58372156) has the molecular formula C39H40F6N2O2 and a molecular weight of 682.75 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-6-[1,1,1,3,3,3-hexafluoro-2-[3-[4-(2-methylpropyl)phenyl]-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-(4-tert-butylphenyl)-6-[1,1,1,3,3,3-hexafluoro-2-[3-[4-(2-methylpropyl)phenyl]-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 58372156 |
| Molecular Formula | C39H40F6N2O2 |
| Molecular Weight | 682.75 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | 3-(4-tert-butylphenyl)-6-[1,1,1,3,3,3-hexafluoro-2-[3-[4-(2-methylpropyl)phenyl]-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | CC(C)Cc1ccc(N2COc3ccc(C(c4ccc5c(c4)CN(c4ccc(C(C)(C)C)cc4)CO5)(C(F)(F)F)C(F)(F)F)cc3C2)cc1 |
| InChI | InChI=1S/C39H40F6N2O2/c1-25(2)18-26-6-12-32(13-7-26)46-21-27-19-30(10-16-34(27)48-23-46)37(38(40,41)42,39(43,44)45)31-11-17-35-28(20-31)22-47(24-49-35)33-14-8-29(9-15-33)36(3,4)5/h6-17,19-20,25H,18,21-24H2,1-5H3 |
| InChIKey | IXIAVDNIEOJWNZ-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.75 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|