C13H13F2O5S- — CID 58372231
2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonate (PubChem CID 58372231) has the molecular formula C13H13F2O5S- and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonate.
| Compound Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 58372231 |
| Molecular Formula | C13H13F2O5S- |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonate |
| SMILES | CC(OC(=O)C1Cc2ccccc2C1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H14F2O5S/c1-8(13(14,15)21(17,18)19)20-12(16)11-6-9-4-2-3-5-10(9)7-11/h2-5,8,11H,6-7H2,1H3,(H,17,18,19)/p-1 |
| InChIKey | VDYRQYJHXSYBMS-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|