C13H14F2O5S — CID 58372232
2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid (PubChem CID 58372232) has the molecular formula C13H14F2O5S and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58372232 |
| Molecular Formula | C13H14F2O5S |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC(=O)C1Cc2ccccc2C1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H14F2O5S/c1-8(13(14,15)21(17,18)19)20-12(16)11-6-9-4-2-3-5-10(9)7-11/h2-5,8,11H,6-7H2,1H3,(H,17,18,19) |
| InChIKey | VDYRQYJHXSYBMS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|