C12H12F2O5S — CID 58372260
2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonic acid (PubChem CID 58372260) has the molecular formula C12H12F2O5S and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58372260 |
| Molecular Formula | C12H12F2O5S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H12F2O5S/c13-12(14,20(16,17)18)7-19-11(15)10-5-8-3-1-2-4-9(8)6-10/h1-4,10H,5-7H2,(H,16,17,18) |
| InChIKey | PWBRDXWJRPFOGY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|