C21H30F4O4 — CID 58372447
1-O-(1-cyclopentylcyclopentyl) 4-O-(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate (PubChem CID 58372447) has the molecular formula C21H30F4O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-O-(1-cyclopentylcyclopentyl) 4-O-(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate.
| Compound Name | 1-O-(1-cyclopentylcyclopentyl) 4-O-(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 58372447 |
| Molecular Formula | C21H30F4O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-O-(1-cyclopentylcyclopentyl) 4-O-(1-ethylcyclopentyl) 2,2,3,3-tetrafluorobutanedioate |
| SMILES | CCC1(OC(=O)C(F)(F)C(F)(F)C(=O)OC2(C3CCCC3)CCCC2)CCCC1 |
| InChI | InChI=1S/C21H30F4O4/c1-2-18(11-5-6-12-18)28-16(26)20(22,23)21(24,25)17(27)29-19(13-7-8-14-19)15-9-3-4-10-15/h15H,2-14H2,1H3 |
| InChIKey | QUAKSAGLRPOGCQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|