C19H3OV- — CID 58372598
nonadeca-1,3,5,7,9,11,13,15,17-nonayne;oxovanadium (PubChem CID 58372598) has the molecular formula C19H3OV- and a molecular weight of 298.18 g/mol. Its IUPAC name is nonadeca-1,3,5,7,9,11,13,15,17-nonayne;oxovanadium.
| Compound Name | nonadeca-1,3,5,7,9,11,13,15,17-nonayne;oxovanadium |
|---|---|
| PubChem CID | 58372598 |
| Molecular Formula | C19H3OV- |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | nonadeca-1,3,5,7,9,11,13,15,17-nonayne;oxovanadium |
| SMILES | O=[V].[C-]#CC#CC#CC#CC#CC#CC#CC#CC#CC |
| InChI | InChI=1S/C19H3.O.V/c1-3-5-7-9-11-13-15-17-19-18-16-14-12-10-8-6-4-2;;/h1H3;;/q-1;; |
| InChIKey | QDERAFXOXQEAKJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|