C17H14BClF2O3 — CID 58373114
1-(2-chloro-3,6-difluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone (PubChem CID 58373114) has the molecular formula C17H14BClF2O3 and a molecular weight of 350.56 g/mol. Its IUPAC name is 1-(2-chloro-3,6-difluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone.
| Compound Name | 1-(2-chloro-3,6-difluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
|---|---|
| PubChem CID | 58373114 |
| Molecular Formula | C17H14BClF2O3 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1-(2-chloro-3,6-difluorophenyl)-2-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)ethanone |
| SMILES | CC1(C)OB(O)c2cc(CC(=O)c3c(F)ccc(F)c3Cl)ccc21 |
| InChI | InChI=1S/C17H14BClF2O3/c1-17(2)10-4-3-9(7-11(10)18(23)24-17)8-14(22)15-12(20)5-6-13(21)16(15)19/h3-7,23H,8H2,1-2H3 |
| InChIKey | ANARJHUEJUWSMX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|