C29H33F2N3O9 — CID 58373212
[(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-morpholin-4-ylethyl carbonate (PubChem CID 58373212) has the molecular formula C29H33F2N3O9 and a molecular weight of 605.59 g/mol. Its IUPAC name is [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-morpholin-4-ylethyl carbonate.
| Compound Name | [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-morpholin-4-ylethyl carbonate |
|---|---|
| PubChem CID | 58373212 |
| Molecular Formula | C29H33F2N3O9 |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-morpholin-4-ylethyl carbonate |
| SMILES | C[C@@H]1CCO[C@H]2Cn3cc(C(=O)CCc4ccc(F)cc4F)c(=O)c(OCOC(=O)OCCN4CCOCC4)c3C(=O)N12 |
| InChI | InChI=1S/C29H33F2N3O9/c1-18-6-10-40-24-16-33-15-21(23(35)5-3-19-2-4-20(30)14-22(19)31)26(36)27(25(33)28(37)34(18)24)42-17-43-29(38)41-13-9-32-7-11-39-12-8-32/h2,4,14-15,18,24H,3,5-13,16-17H2,1H3/t18-,24+/m1/s1 |
| InChIKey | GUEOTWYWSICKSO-KOSHJBKYSA-N |
| XLogP | 2.35 |
| TPSA | 125.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|