C26H26F2N2O9 — CID 58373216
[(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-oxopropyl carbonate (PubChem CID 58373216) has the molecular formula C26H26F2N2O9 and a molecular weight of 548.50 g/mol. Its IUPAC name is [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-oxopropyl carbonate.
| Compound Name | [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-oxopropyl carbonate |
|---|---|
| PubChem CID | 58373216 |
| Molecular Formula | C26H26F2N2O9 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-oxopropyl carbonate |
| SMILES | CC(=O)COC(=O)OCOc1c2n(cc(C(=O)CCc3ccc(F)cc3F)c1=O)C[C@@H]1OCC[C@@H](C)N1C2=O |
| InChI | InChI=1S/C26H26F2N2O9/c1-14-7-8-36-21-11-29-10-18(20(32)6-4-16-3-5-17(27)9-19(16)28)23(33)24(22(29)25(34)30(14)21)38-13-39-26(35)37-12-15(2)31/h3,5,9-10,14,21H,4,6-8,11-13H2,1-2H3/t14-,21+/m1/s1 |
| InChIKey | XZKXQQQOVIPZFW-SZNDQCEHSA-N |
| XLogP | 2.61 |
| TPSA | 130.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|