C26H28F2N2O9 — CID 58373220
[(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 58373220) has the molecular formula C26H28F2N2O9 and a molecular weight of 550.51 g/mol. Its IUPAC name is [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 58373220 |
| Molecular Formula | C26H28F2N2O9 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [(3S,7R)-13-[3-(2,4-difluorophenyl)propanoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOc1c2n(cc(C(=O)CCc3ccc(F)cc3F)c1=O)C[C@@H]1OCC[C@@H](C)N1C2=O |
| InChI | InChI=1S/C26H28F2N2O9/c1-15-7-8-36-21-13-29-12-18(20(31)6-4-16-3-5-17(27)11-19(16)28)23(32)24(22(29)25(33)30(15)21)38-14-39-26(34)37-10-9-35-2/h3,5,11-12,15,21H,4,6-10,13-14H2,1-2H3/t15-,21+/m1/s1 |
| InChIKey | RDTIBRGZRQNSAX-VFNWGFHPSA-N |
| XLogP | 2.67 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|