C25H29ClN2O4 — CID 58373228
(6E,10E,12Z)-15-chloro-12-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 58373228) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is (6E,10E,12Z)-15-chloro-12-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E,12Z)-15-chloro-12-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 58373228 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (6E,10E,12Z)-15-chloro-12-[2-(2,5-dihydropyrrol-1-yl)-2-oxoethoxy]imino-16,18-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | Cc1cc(C)c2c(c1Cl)CC(=N/OCC(=O)N1CC=CC1)/C=C/CC/C=C/CCOC2=O |
| InChI | InChI=1S/C25H29ClN2O4/c1-18-15-19(2)24(26)21-16-20(27-32-17-22(29)28-12-8-9-13-28)11-7-5-3-4-6-10-14-31-25(30)23(18)21/h4,6-9,11,15H,3,5,10,12-14,16-17H2,1-2H3/b6-4+,11-7+,27-20+ |
| InChIKey | WCMRWXNDIFFKJB-PXNMMZJDSA-N |
| XLogP | 4.72 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|