C29H42N2O4 — CID 58373468
N,N-diethyl-2-[(E)-[(6E,10E)-10,16,18-trimethyl-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide (PubChem CID 58373468) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is N,N-diethyl-2-[(E)-[(6E,10E)-10,16,18-trimethyl-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide.
| Compound Name | N,N-diethyl-2-[(E)-[(6E,10E)-10,16,18-trimethyl-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 58373468 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | N,N-diethyl-2-[(E)-[(6E,10E)-10,16,18-trimethyl-2-oxo-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,10,14,16-pentaen-12-ylidene]amino]oxyacetamide |
| SMILES | CCCC1C/C=C/CC/C(C)=C/C(=N/OCC(=O)N(CC)CC)Cc2cc(C)cc(C)c2C(=O)O1 |
| InChI | InChI=1S/C29H42N2O4/c1-7-13-26-15-12-10-11-14-21(4)18-25(30-34-20-27(32)31(8-2)9-3)19-24-17-22(5)16-23(6)28(24)29(33)35-26/h10,12,16-18,26H,7-9,11,13-15,19-20H2,1-6H3/b12-10+,21-18+,30-25- |
| InChIKey | NMEKXKFKNBVEIU-UCTSDHDUSA-N |
| XLogP | 6.10 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|