About [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane
[(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane (PubChem CID 58373581) has the molecular formula C20H44O2Si3
and a molecular weight of 400.83 g/mol. Its IUPAC name is [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane |
| PubChem CID | 58373581 |
| Molecular Formula | C20H44O2Si3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O2Si3/c1-19(2,3)24(10,11)21-17-18(15-14-16-23(7,8)9)22-25(12,13)20(4,5)6/h18H,15,17H2,1-13H3/t18-/m1/s1 |
| InChIKey | POZMPKDPRRFJDI-GOSISDBHSA-N |
| XLogP | 6.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane?
The IUPAC name of [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane (CID 58373581) is [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane?
The canonical SMILES for [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane is CC(C)(C)[Si](C)(C)OC[C@@H](CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane?
The InChIKey is POZMPKDPRRFJDI-GOSISDBHSA-N. The full InChI is InChI=1S/C20H44O2Si3/c1-19(2,3)24(10,11)21-17-18(15-14-16-23(7,8)9)22-25(12,13)20(4,5)6/h18H,15,17H2,1-13H3/t18-/m1/s1.
What are the key properties of [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane?
[(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane has a molecular weight of 400.83 g/mol, XLogP of 6.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pent-1-ynyl]-trimethylsilane is sourced from PubChem (CID 58373581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).