C20H30O2Si — CID 58373599
methyl (8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 58373599) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is methyl (8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | methyl (8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 58373599 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | methyl (8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | COC(=O)CCCCC#C/C=C/C=C/[C@H](C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C20H30O2Si/c1-19(16-14-18-23(3,4)5)15-12-10-8-6-7-9-11-13-17-20(21)22-2/h8,10,12,15,19H,9,11,13,16-17H2,1-5H3/b10-8+,15-12+/t19-/m0/s1 |
| InChIKey | BMRAVVHNZLDKAW-RYQQSTTKSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|