About 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine
3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine (PubChem CID 58373859) has the molecular formula C27H24ClNO4
and a molecular weight of 461.95 g/mol. Its IUPAC name is 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine.
Molecular Properties
| Compound Name | 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine |
| PubChem CID | 58373859 |
| Molecular Formula | C27H24ClNO4 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine |
| SMILES | COc1ccc(COc2ccc(-c3cccnc3)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H24ClNO4/c1-30-22-9-5-19(6-10-22)17-32-25-14-13-24(21-4-3-15-29-16-21)26(28)27(25)33-18-20-7-11-23(31-2)12-8-20/h3-16H,17-18H2,1-2H3 |
| InChIKey | QVMXSFBVFKSJEM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine?
The IUPAC name of 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine (CID 58373859) is 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine.
What is the SMILES notation for 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine?
The canonical SMILES for 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine is COc1ccc(COc2ccc(-c3cccnc3)c(Cl)c2OCc2ccc(OC)cc2)cc1.
What is the InChIKey of 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine?
The InChIKey is QVMXSFBVFKSJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24ClNO4/c1-30-22-9-5-19(6-10-22)17-32-25-14-13-24(21-4-3-15-29-16-21)26(28)27(25)33-18-20-7-11-23(31-2)12-8-20/h3-16H,17-18H2,1-2H3.
What are the key properties of 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine?
3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine has a molecular weight of 461.95 g/mol, XLogP of 6.58, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]pyridine is sourced from PubChem (CID 58373859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).