About 3-ethoxy-1H-isoindole
3-ethoxy-1H-isoindole (PubChem CID 583742) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-ethoxy-1H-isoindole.
Molecular Properties
| Compound Name | 3-ethoxy-1H-isoindole |
| PubChem CID | 583742 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-ethoxy-1H-isoindole |
| SMILES | CCOC1=NCc2ccccc21 |
| InChI | InChI=1S/C10H11NO/c1-2-12-10-9-6-4-3-5-8(9)7-11-10/h3-6H,2,7H2,1H3 |
| InChIKey | RSSQOCHQZAYJLZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1H-isoindole?
The IUPAC name of 3-ethoxy-1H-isoindole (CID 583742) is 3-ethoxy-1H-isoindole.
What is the SMILES notation for 3-ethoxy-1H-isoindole?
The canonical SMILES for 3-ethoxy-1H-isoindole is CCOC1=NCc2ccccc21.
What is the InChIKey of 3-ethoxy-1H-isoindole?
The InChIKey is RSSQOCHQZAYJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-12-10-9-6-4-3-5-8(9)7-11-10/h3-6H,2,7H2,1H3.
What are the key properties of 3-ethoxy-1H-isoindole?
3-ethoxy-1H-isoindole has a molecular weight of 161.20 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1H-isoindole is sourced from PubChem (CID 583742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).