C20H20Cl2F3NO2 — CID 58374433
3-[[2-chloro-5-[(2S)-2-(4-chloro-3-methylphenyl)-3,3,3-trifluoropropyl]phenyl]methylamino]propanoic acid (PubChem CID 58374433) has the molecular formula C20H20Cl2F3NO2 and a molecular weight of 434.29 g/mol. Its IUPAC name is 3-[[2-chloro-5-[(2S)-2-(4-chloro-3-methylphenyl)-3,3,3-trifluoropropyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[2-chloro-5-[(2S)-2-(4-chloro-3-methylphenyl)-3,3,3-trifluoropropyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 58374433 |
| Molecular Formula | C20H20Cl2F3NO2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 3-[[2-chloro-5-[(2S)-2-(4-chloro-3-methylphenyl)-3,3,3-trifluoropropyl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1cc([C@H](Cc2ccc(Cl)c(CNCCC(=O)O)c2)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C20H20Cl2F3NO2/c1-12-8-14(3-5-17(12)21)16(20(23,24)25)10-13-2-4-18(22)15(9-13)11-26-7-6-19(27)28/h2-5,8-9,16,26H,6-7,10-11H2,1H3,(H,27,28)/t16-/m0/s1 |
| InChIKey | OUZVEFRCYFGEDS-INIZCTEOSA-N |
| XLogP | 5.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|