C23H25F3N6O — CID 58374588
N-[5-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide (PubChem CID 58374588) has the molecular formula C23H25F3N6O and a molecular weight of 458.49 g/mol. Its IUPAC name is N-[5-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 58374588 |
| Molecular Formula | C23H25F3N6O |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[5-[4-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1nc2cccc(-c3ccc(CN4CCN(CC(F)(F)F)CC4)cc3)n2n1)C1CC1 |
| InChI | InChI=1S/C23H25F3N6O/c24-23(25,26)15-31-12-10-30(11-13-31)14-16-4-6-17(7-5-16)19-2-1-3-20-27-22(29-32(19)20)28-21(33)18-8-9-18/h1-7,18H,8-15H2,(H,28,29,33) |
| InChIKey | MRPSGBHFKSOAAQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |