C32H36N6O2 — CID 58374682
4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]-N-[(4-piperidin-1-ylphenyl)methyl]-N-propan-2-ylbenzamide (PubChem CID 58374682) has the molecular formula C32H36N6O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]-N-[(4-piperidin-1-ylphenyl)methyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]-N-[(4-piperidin-1-ylphenyl)methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 58374682 |
| Molecular Formula | C32H36N6O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 4-[2-(cyclopropanecarbonylamino)-[1,2,4]triazolo[1,5-a]pyridin-5-yl]-N-[(4-piperidin-1-ylphenyl)methyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(Cc1ccc(N2CCCCC2)cc1)C(=O)c1ccc(-c2cccc3nc(NC(=O)C4CC4)nn23)cc1 |
| InChI | InChI=1S/C32H36N6O2/c1-22(2)37(21-23-9-17-27(18-10-23)36-19-4-3-5-20-36)31(40)26-15-11-24(12-16-26)28-7-6-8-29-33-32(35-38(28)29)34-30(39)25-13-14-25/h6-12,15-18,22,25H,3-5,13-14,19-21H2,1-2H3,(H,34,35,39) |
| InChIKey | ORORXMRJOHZKTO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|