C21H21N5O4S — CID 58374815
N-[5-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide (PubChem CID 58374815) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[5-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 58374815 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[5-[4-(1,1-dioxo-1,4-thiazinane-4-carbonyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1nc2cccc(-c3ccc(C(=O)N4CCS(=O)(=O)CC4)cc3)n2n1)C1CC1 |
| InChI | InChI=1S/C21H21N5O4S/c27-19(15-6-7-15)23-21-22-18-3-1-2-17(26(18)24-21)14-4-8-16(9-5-14)20(28)25-10-12-31(29,30)13-11-25/h1-5,8-9,15H,6-7,10-13H2,(H,23,24,27) |
| InChIKey | WZXWEHPCVGAYTR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |