C16H15FIN3O5 — CID 58374869
2-[[4-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl]amino]acetic acid (PubChem CID 58374869) has the molecular formula C16H15FIN3O5 and a molecular weight of 475.21 g/mol. Its IUPAC name is 2-[[4-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 58374869 |
| Molecular Formula | C16H15FIN3O5 |
| Molecular Weight | 475.21 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | 2-[[4-[(2-fluoro-4-iodophenyl)methyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl]amino]acetic acid |
| SMILES | Cn1c(Cc2ccc(I)cc2F)c(C(=O)NCC(=O)O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H15FIN3O5/c1-20-11(5-8-3-4-9(18)6-10(8)17)13(14(24)19-7-12(22)23)15(25)21(2)16(20)26/h3-4,6H,5,7H2,1-2H3,(H,19,24)(H,22,23) |
| InChIKey | GEFSVWXCXHFOAZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|