C27H34N2O3 — CID 58374936
[4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone (PubChem CID 58374936) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is [4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone.
| Compound Name | [4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
|---|---|
| PubChem CID | 58374936 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | [4-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]-[(1S,9S)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
| SMILES | CC1(C)[C@@H]2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)c1ccc(CN2CCC(O)C2)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-26(2)24-15-21-22(5-4-6-23(21)31)27(26,3)12-14-29(24)25(32)19-9-7-18(8-10-19)16-28-13-11-20(30)17-28/h4-10,20,24,30-31H,11-17H2,1-3H3/t20?,24-,27-/m0/s1 |
| InChIKey | IQSYDXASVBGAIW-NPMFMFCHSA-N |
| XLogP | 3.71 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |