C23H27NO2 — CID 58375153
[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3-methylphenyl)methanone (PubChem CID 58375153) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is [(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3-methylphenyl)methanone.
| Compound Name | [(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 58375153 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CC[C@@]3(C)c4cccc(O)c4C[C@@H]2C3(C)C)c1 |
| InChI | InChI=1S/C23H27NO2/c1-15-7-5-8-16(13-15)21(26)24-12-11-23(4)18-9-6-10-19(25)17(18)14-20(24)22(23,2)3/h5-10,13,20,25H,11-12,14H2,1-4H3/t20-,23+/m1/s1 |
| InChIKey | FZYRPXPURNQMLM-OFNKIYASSA-N |
| XLogP | 4.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |