C18H23N3 — CID 58375196
(1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaene (PubChem CID 58375196) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaene.
| Compound Name | (1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 58375196 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | (1S,13R)-1,6,17,17-tetramethyl-5,8,14-triazatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4,6,8,10-pentaene |
| SMILES | Cc1cnc2cc3c(cc2n1)[C@]1(C)CCN[C@H](C3)C1(C)C |
| InChI | InChI=1S/C18H23N3/c1-11-10-20-14-7-12-8-16-17(2,3)18(4,5-6-19-16)13(12)9-15(14)21-11/h7,9-10,16,19H,5-6,8H2,1-4H3/t16-,18+/m1/s1 |
| InChIKey | WHNWQMQSFFKEOX-AEFFLSMTSA-N |
| XLogP | 3.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |