C28H27N3O — CID 58375219
[(1R,9R,13S)-1,13-dimethyl-4-pyridin-4-yl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3H-indol-5-yl)methanone (PubChem CID 58375219) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is [(1R,9R,13S)-1,13-dimethyl-4-pyridin-4-yl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3H-indol-5-yl)methanone.
| Compound Name | [(1R,9R,13S)-1,13-dimethyl-4-pyridin-4-yl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 58375219 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | [(1R,9R,13S)-1,13-dimethyl-4-pyridin-4-yl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-(3H-indol-5-yl)methanone |
| SMILES | C[C@@H]1[C@H]2Cc3ccc(-c4ccncc4)cc3[C@]1(C)CCN2C(=O)c1ccc2c(c1)CC=N2 |
| InChI | InChI=1S/C28H27N3O/c1-18-26-17-21-4-3-20(19-7-11-29-12-8-19)16-24(21)28(18,2)10-14-31(26)27(32)23-5-6-25-22(15-23)9-13-30-25/h3-8,11-13,15-16,18,26H,9-10,14,17H2,1-2H3/t18-,26-,28-/m1/s1 |
| InChIKey | WHRGFBFZZQJTEE-MDKLSPHFSA-N |
| XLogP | 5.37 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |