C24H23N3O — CID 58375241
(1R,9R,13S)-10-(3H-indole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile (PubChem CID 58375241) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (1R,9R,13S)-10-(3H-indole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile.
| Compound Name | (1R,9R,13S)-10-(3H-indole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile |
|---|---|
| PubChem CID | 58375241 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (1R,9R,13S)-10-(3H-indole-5-carbonyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5-carbonitrile |
| SMILES | C[C@@H]1[C@H]2Cc3cc(C#N)ccc3[C@]1(C)CCN2C(=O)c1ccc2c(c1)CC=N2 |
| InChI | InChI=1S/C24H23N3O/c1-15-22-13-19-11-16(14-25)3-5-20(19)24(15,2)8-10-27(22)23(28)18-4-6-21-17(12-18)7-9-26-21/h3-6,9,11-12,15,22H,7-8,10,13H2,1-2H3/t15-,22-,24-/m1/s1 |
| InChIKey | DOJLRWBZNALBED-PKAUSPCKSA-N |
| XLogP | 4.18 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |