C9H12O5S — CID 58375455
(1-oxo-3a,4,5,6-tetrahydro-3H-2-benzofuran-4-yl) methanesulfonate (PubChem CID 58375455) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is (1-oxo-3a,4,5,6-tetrahydro-3H-2-benzofuran-4-yl) methanesulfonate.
| Compound Name | (1-oxo-3a,4,5,6-tetrahydro-3H-2-benzofuran-4-yl) methanesulfonate |
|---|---|
| PubChem CID | 58375455 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (1-oxo-3a,4,5,6-tetrahydro-3H-2-benzofuran-4-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCC=C2C(=O)OCC21 |
| InChI | InChI=1S/C9H12O5S/c1-15(11,12)14-8-4-2-3-6-7(8)5-13-9(6)10/h3,7-8H,2,4-5H2,1H3 |
| InChIKey | WZHCTEYEKOFXNV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|