About 4-ethoxy-2,6-dimethyloxane
4-ethoxy-2,6-dimethyloxane (PubChem CID 58376118) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-ethoxy-2,6-dimethyloxane.
Molecular Properties
| Compound Name | 4-ethoxy-2,6-dimethyloxane |
| PubChem CID | 58376118 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 4-ethoxy-2,6-dimethyloxane |
| SMILES | CCOC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C9H18O2/c1-4-10-9-5-7(2)11-8(3)6-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | FYBBHDBYZAXPQQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxy-2,6-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2,6-dimethyloxane?
The IUPAC name of 4-ethoxy-2,6-dimethyloxane (CID 58376118) is 4-ethoxy-2,6-dimethyloxane.
What is the SMILES notation for 4-ethoxy-2,6-dimethyloxane?
The canonical SMILES for 4-ethoxy-2,6-dimethyloxane is CCOC1CC(C)OC(C)C1.
What is the InChIKey of 4-ethoxy-2,6-dimethyloxane?
The InChIKey is FYBBHDBYZAXPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-4-10-9-5-7(2)11-8(3)6-9/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-ethoxy-2,6-dimethyloxane?
4-ethoxy-2,6-dimethyloxane has a molecular weight of 158.24 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2,6-dimethyloxane is sourced from PubChem (CID 58376118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).