C25H35N3O4 — CID 58376687
7-cyano-N-cyclohexyl-4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide (PubChem CID 58376687) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 7-cyano-N-cyclohexyl-4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide.
| Compound Name | 7-cyano-N-cyclohexyl-4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 58376687 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 7-cyano-N-cyclohexyl-4-(3-methoxypropyl)-2,2-dimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide |
| SMILES | COCCCN1C(=O)C(C)(C)Oc2cc(C#N)c(C(=O)N(C(C)C)C3CCCCC3)cc21 |
| InChI | InChI=1S/C25H35N3O4/c1-17(2)28(19-10-7-6-8-11-19)23(29)20-15-21-22(14-18(20)16-26)32-25(3,4)24(30)27(21)12-9-13-31-5/h14-15,17,19H,6-13H2,1-5H3 |
| InChIKey | VLOQENOFMJTXIB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|