About N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide
N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide (PubChem CID 58376855) has the molecular formula C14H23F2NO
and a molecular weight of 259.34 g/mol. Its IUPAC name is N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide |
| PubChem CID | 58376855 |
| Molecular Formula | C14H23F2NO |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide |
| SMILES | CCCN(C(=O)CC1CCC(F)(F)CC1)C1CC1 |
| InChI | InChI=1S/C14H23F2NO/c1-2-9-17(12-3-4-12)13(18)10-11-5-7-14(15,16)8-6-11/h11-12H,2-10H2,1H3 |
| InChIKey | BNGMYJJPXDKSLG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide?
The IUPAC name of N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide (CID 58376855) is N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide.
What is the SMILES notation for N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide?
The canonical SMILES for N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide is CCCN(C(=O)CC1CCC(F)(F)CC1)C1CC1.
What is the InChIKey of N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide?
The InChIKey is BNGMYJJPXDKSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F2NO/c1-2-9-17(12-3-4-12)13(18)10-11-5-7-14(15,16)8-6-11/h11-12H,2-10H2,1H3.
What are the key properties of N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide?
N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide has a molecular weight of 259.34 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-(4,4-difluorocyclohexyl)-N-propylacetamide is sourced from PubChem (CID 58376855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).