C21H22F3NO2 — CID 58376979
1-[3-[1,1,1-trifluoro-2-[(2-hydroxy-1-phenylethyl)amino]but-3-en-2-yl]phenyl]propan-2-one (PubChem CID 58376979) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 1-[3-[1,1,1-trifluoro-2-[(2-hydroxy-1-phenylethyl)amino]but-3-en-2-yl]phenyl]propan-2-one.
| Compound Name | 1-[3-[1,1,1-trifluoro-2-[(2-hydroxy-1-phenylethyl)amino]but-3-en-2-yl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 58376979 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[3-[1,1,1-trifluoro-2-[(2-hydroxy-1-phenylethyl)amino]but-3-en-2-yl]phenyl]propan-2-one |
| SMILES | C=CC(NC(CO)c1ccccc1)(c1cccc(CC(C)=O)c1)C(F)(F)F |
| InChI | InChI=1S/C21H22F3NO2/c1-3-20(21(22,23)24,18-11-7-8-16(13-18)12-15(2)27)25-19(14-26)17-9-5-4-6-10-17/h3-11,13,19,25-26H,1,12,14H2,2H3 |
| InChIKey | ZLCSLLYQZHZRRF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|