C21H23Cl2N3O2 — CID 58378262
N-[4-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]-4-oxobutyl]benzamide (PubChem CID 58378262) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is N-[4-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 58378262 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[4-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]-4-oxobutyl]benzamide |
| SMILES | O=C(NCCCC(=O)C1CCN(c2c(Cl)cncc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c22-17-13-24-14-18(23)20(17)26-11-8-15(9-12-26)19(27)7-4-10-25-21(28)16-5-2-1-3-6-16/h1-3,5-6,13-15H,4,7-12H2,(H,25,28) |
| InChIKey | LAOLDEIOESVAAM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|