About carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium
carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium (PubChem CID 58378569) has the molecular formula C8H14N2O3Y-2
and a molecular weight of 275.12 g/mol. Its IUPAC name is carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium.
Molecular Properties
| Compound Name | carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium |
| PubChem CID | 58378569 |
| Molecular Formula | C8H14N2O3Y-2 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium |
| SMILES | O=C(O)CON=C1CC[N-]CC1.[CH3-].[Y] |
| InChI | InChI=1S/C7H11N2O3.CH3.Y/c10-7(11)5-12-9-6-1-3-8-4-2-6;;/h1-5H2,(H,10,11);1H3;/q2*-1; |
| InChIKey | GUKNEPOZEKZAAM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium?
The IUPAC name of carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium (CID 58378569) is carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium.
What is the SMILES notation for carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium?
The canonical SMILES for carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium is O=C(O)CON=C1CC[N-]CC1.[CH3-].[Y].
What is the InChIKey of carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium?
The InChIKey is GUKNEPOZEKZAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N2O3.CH3.Y/c10-7(11)5-12-9-6-1-3-8-4-2-6;;/h1-5H2,(H,10,11);1H3;/q2*-1;.
What are the key properties of carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium?
carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium has a molecular weight of 275.12 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-(piperidin-1-id-4-ylideneamino)oxyacetic acid;yttrium is sourced from PubChem (CID 58378569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).