About 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one
4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one (PubChem CID 58378786) has the molecular formula C23H19F2NO4S
and a molecular weight of 443.47 g/mol. Its IUPAC name is 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 58378786 |
| Molecular Formula | C23H19F2NO4S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OCC1c1cccc(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C23H19F2NO4S/c1-26-22(13-30-23(26)27)17-4-2-3-15(11-17)14-31(28,29)19-8-5-16(6-9-19)20-10-7-18(24)12-21(20)25/h2-12,22H,13-14H2,1H3 |
| InChIKey | WTHBZEZKQTWXMQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one (CID 58378786) is 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one is CN1C(=O)OCC1c1cccc(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1.
What is the InChIKey of 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one?
The InChIKey is WTHBZEZKQTWXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F2NO4S/c1-26-22(13-30-23(26)27)17-4-2-3-15(11-17)14-31(28,29)19-8-5-16(6-9-19)20-10-7-18(24)12-21(20)25/h2-12,22H,13-14H2,1H3.
What are the key properties of 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one?
4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one has a molecular weight of 443.47 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]-3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 58378786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).